C23H47IO3Si2 — CID 134846498
tert-butyl-[2-[(4S,5S,6R)-2,2-ditert-butyl-6-[(Z)-1-iodoprop-1-en-2-yl]-5-methyl-1,3,2-dioxasilinan-4-yl]ethoxy]-dimethylsilane (PubChem CID 134846498) has the molecular formula C23H47IO3Si2 and a molecular weight of 554.70 g/mol. Its IUPAC name is tert-butyl-[2-[(4S,5S,6R)-2,2-ditert-butyl-6-[(Z)-1-iodoprop-1-en-2-yl]-5-methyl-1,3,2-dioxasilinan-4-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[(4S,5S,6R)-2,2-ditert-butyl-6-[(Z)-1-iodoprop-1-en-2-yl]-5-methyl-1,3,2-dioxasilinan-4-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134846498 |
| Molecular Formula | C23H47IO3Si2 |
| Molecular Weight | 554.70 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | tert-butyl-[2-[(4S,5S,6R)-2,2-ditert-butyl-6-[(Z)-1-iodoprop-1-en-2-yl]-5-methyl-1,3,2-dioxasilinan-4-yl]ethoxy]-dimethylsilane |
| SMILES | C/C(=C/I)[C@@H]1O[Si](C(C)(C)C)(C(C)(C)C)O[C@@H](CCO[Si](C)(C)C(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C23H47IO3Si2/c1-17(16-24)20-18(2)19(14-15-25-28(12,13)21(3,4)5)26-29(27-20,22(6,7)8)23(9,10)11/h16,18-20H,14-15H2,1-13H3/b17-16-/t18-,19-,20-/m0/s1 |
| InChIKey | FXWHUYZSTXSMBE-UTYYPCBTSA-N |
| XLogP | 8.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.70 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|