C38H43NO5S — CID 134846805
N-but-3-enyl-4-methyl-N-[(2R,3R,4R)-1,3,4-tris(phenylmethoxy)hex-5-en-2-yl]benzenesulfonamide (PubChem CID 134846805) has the molecular formula C38H43NO5S and a molecular weight of 625.83 g/mol. Its IUPAC name is N-but-3-enyl-4-methyl-N-[(2R,3R,4R)-1,3,4-tris(phenylmethoxy)hex-5-en-2-yl]benzenesulfonamide.
| Compound Name | N-but-3-enyl-4-methyl-N-[(2R,3R,4R)-1,3,4-tris(phenylmethoxy)hex-5-en-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 134846805 |
| Molecular Formula | C38H43NO5S |
| Molecular Weight | 625.83 g/mol |
| Exact Mass | 625.29 |
| IUPAC Name | N-but-3-enyl-4-methyl-N-[(2R,3R,4R)-1,3,4-tris(phenylmethoxy)hex-5-en-2-yl]benzenesulfonamide |
| SMILES | C=CCCN([C@H](COCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](C=C)OCc1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C38H43NO5S/c1-4-6-26-39(45(40,41)35-24-22-31(3)23-25-35)36(30-42-27-32-16-10-7-11-17-32)38(44-29-34-20-14-9-15-21-34)37(5-2)43-28-33-18-12-8-13-19-33/h4-5,7-25,36-38H,1-2,6,26-30H2,3H3/t36-,37-,38-/m1/s1 |
| InChIKey | YVJDSUQDBYTSFO-UJTUJTOWSA-N |
| XLogP | 7.50 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.83 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|