C32H39NO5 — CID 134847060
tert-butyl N-[(2R,3R,4R)-1,3,4-tris(phenylmethoxy)hex-5-en-2-yl]carbamate (PubChem CID 134847060) has the molecular formula C32H39NO5 and a molecular weight of 517.67 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R,4R)-1,3,4-tris(phenylmethoxy)hex-5-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R,4R)-1,3,4-tris(phenylmethoxy)hex-5-en-2-yl]carbamate |
|---|---|
| PubChem CID | 134847060 |
| Molecular Formula | C32H39NO5 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.28 |
| IUPAC Name | tert-butyl N-[(2R,3R,4R)-1,3,4-tris(phenylmethoxy)hex-5-en-2-yl]carbamate |
| SMILES | C=C[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](COCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H39NO5/c1-5-29(36-22-26-17-11-7-12-18-26)30(37-23-27-19-13-8-14-20-27)28(33-31(34)38-32(2,3)4)24-35-21-25-15-9-6-10-16-25/h5-20,28-30H,1,21-24H2,2-4H3,(H,33,34)/t28-,29-,30-/m1/s1 |
| InChIKey | RYYMBTHQTKQIKO-IDZRBWSNSA-N |
| XLogP | 6.45 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|