C29H44N3O3S+ — CID 134847671
[[5-(2-butylsulfanylethyl)-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] N-tert-butylcarbamate (PubChem CID 134847671) has the molecular formula C29H44N3O3S+ and a molecular weight of 514.76 g/mol. Its IUPAC name is [[5-(2-butylsulfanylethyl)-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] N-tert-butylcarbamate.
| Compound Name | [[5-(2-butylsulfanylethyl)-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 134847671 |
| Molecular Formula | C29H44N3O3S+ |
| Molecular Weight | 514.76 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | [[5-(2-butylsulfanylethyl)-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] N-tert-butylcarbamate |
| SMILES | CCCCSCCC1C[NH+]2CCC1CC2C(OC(=O)NC(C)(C)C)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C29H43N3O3S/c1-6-7-15-36-16-12-21-19-32-14-11-20(21)17-26(32)27(35-28(33)31-29(2,3)4)23-10-13-30-25-9-8-22(34-5)18-24(23)25/h8-10,13,18,20-21,26-27H,6-7,11-12,14-17,19H2,1-5H3,(H,31,33)/p+1 |
| InChIKey | IHEOTNFTRGDJDM-UHFFFAOYSA-O |
| XLogP | 5.03 |
| TPSA | 64.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.76 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|