C15H18FNO3 — CID 134849321
(2S,3R,6S)-2-(4-fluoro-3-nitrophenyl)-6-methyl-3-prop-1-en-2-yloxane (PubChem CID 134849321) has the molecular formula C15H18FNO3 and a molecular weight of 279.31 g/mol. Its IUPAC name is (2S,3R,6S)-2-(4-fluoro-3-nitrophenyl)-6-methyl-3-prop-1-en-2-yloxane.
| Compound Name | (2S,3R,6S)-2-(4-fluoro-3-nitrophenyl)-6-methyl-3-prop-1-en-2-yloxane |
|---|---|
| PubChem CID | 134849321 |
| Molecular Formula | C15H18FNO3 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | (2S,3R,6S)-2-(4-fluoro-3-nitrophenyl)-6-methyl-3-prop-1-en-2-yloxane |
| SMILES | C=C(C)[C@H]1CC[C@H](C)O[C@@H]1c1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H18FNO3/c1-9(2)12-6-4-10(3)20-15(12)11-5-7-13(16)14(8-11)17(18)19/h5,7-8,10,12,15H,1,4,6H2,2-3H3/t10-,12+,15+/m0/s1 |
| InChIKey | BMIFJBUOOFKXAG-JVLSTEMRSA-N |
| XLogP | 4.17 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|