C17H17FN2O2 — CID 141309201
2-(4-fluoro-3-nitrophenyl)-3,3-dimethyl-2,4-dihydro-1H-quinoline (PubChem CID 141309201) has the molecular formula C17H17FN2O2 and a molecular weight of 300.33 g/mol. Its IUPAC name is 2-(4-fluoro-3-nitrophenyl)-3,3-dimethyl-2,4-dihydro-1H-quinoline.
| Compound Name | 2-(4-fluoro-3-nitrophenyl)-3,3-dimethyl-2,4-dihydro-1H-quinoline |
|---|---|
| PubChem CID | 141309201 |
| Molecular Formula | C17H17FN2O2 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-(4-fluoro-3-nitrophenyl)-3,3-dimethyl-2,4-dihydro-1H-quinoline |
| SMILES | CC1(C)Cc2ccccc2NC1c1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H17FN2O2/c1-17(2)10-12-5-3-4-6-14(12)19-16(17)11-7-8-13(18)15(9-11)20(21)22/h3-9,16,19H,10H2,1-2H3 |
| InChIKey | OLTMBPFVWOSNAN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|