C19H19FN2O5 — CID 67442290
methyl 2-(4-fluoro-3-nitrophenyl)-4-hydroxy-3,3-dimethyl-2,4-dihydro-1H-quinoline-6-carboxylate (PubChem CID 67442290) has the molecular formula C19H19FN2O5 and a molecular weight of 374.37 g/mol. Its IUPAC name is methyl 2-(4-fluoro-3-nitrophenyl)-4-hydroxy-3,3-dimethyl-2,4-dihydro-1H-quinoline-6-carboxylate.
| Compound Name | methyl 2-(4-fluoro-3-nitrophenyl)-4-hydroxy-3,3-dimethyl-2,4-dihydro-1H-quinoline-6-carboxylate |
|---|---|
| PubChem CID | 67442290 |
| Molecular Formula | C19H19FN2O5 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | methyl 2-(4-fluoro-3-nitrophenyl)-4-hydroxy-3,3-dimethyl-2,4-dihydro-1H-quinoline-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C(O)C(C)(C)C(c1ccc(F)c([N+](=O)[O-])c1)N2 |
| InChI | InChI=1S/C19H19FN2O5/c1-19(2)16(10-4-6-13(20)15(9-10)22(25)26)21-14-7-5-11(18(24)27-3)8-12(14)17(19)23/h4-9,16-17,21,23H,1-3H3 |
| InChIKey | DMGZQCHHNXVNSO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|