C19H28N2O3Si — CID 134850497
ethyl 4-[tert-butyl(dimethyl)silyl]oxy-4-cyano-2-methylidene-4-pyridin-3-ylbutanoate (PubChem CID 134850497) has the molecular formula C19H28N2O3Si and a molecular weight of 360.53 g/mol. Its IUPAC name is ethyl 4-[tert-butyl(dimethyl)silyl]oxy-4-cyano-2-methylidene-4-pyridin-3-ylbutanoate.
| Compound Name | ethyl 4-[tert-butyl(dimethyl)silyl]oxy-4-cyano-2-methylidene-4-pyridin-3-ylbutanoate |
|---|---|
| PubChem CID | 134850497 |
| Molecular Formula | C19H28N2O3Si |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | ethyl 4-[tert-butyl(dimethyl)silyl]oxy-4-cyano-2-methylidene-4-pyridin-3-ylbutanoate |
| SMILES | C=C(CC(C#N)(O[Si](C)(C)C(C)(C)C)c1cccnc1)C(=O)OCC |
| InChI | InChI=1S/C19H28N2O3Si/c1-8-23-17(22)15(2)12-19(14-20,16-10-9-11-21-13-16)24-25(6,7)18(3,4)5/h9-11,13H,2,8,12H2,1,3-7H3 |
| InChIKey | HJLOJVXZGDYFES-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 72.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|