C30H37N3O4Si — CID 91604610
ethyl 2-[[tert-butyl(dimethyl)silyl]oxy-cyano-pyridin-3-ylmethyl]-4-(4-hydroxyphenyl)-3-pyridin-3-ylbutanoate (PubChem CID 91604610) has the molecular formula C30H37N3O4Si and a molecular weight of 531.73 g/mol. Its IUPAC name is ethyl 2-[[tert-butyl(dimethyl)silyl]oxy-cyano-pyridin-3-ylmethyl]-4-(4-hydroxyphenyl)-3-pyridin-3-ylbutanoate.
| Compound Name | ethyl 2-[[tert-butyl(dimethyl)silyl]oxy-cyano-pyridin-3-ylmethyl]-4-(4-hydroxyphenyl)-3-pyridin-3-ylbutanoate |
|---|---|
| PubChem CID | 91604610 |
| Molecular Formula | C30H37N3O4Si |
| Molecular Weight | 531.73 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | ethyl 2-[[tert-butyl(dimethyl)silyl]oxy-cyano-pyridin-3-ylmethyl]-4-(4-hydroxyphenyl)-3-pyridin-3-ylbutanoate |
| SMILES | CCOC(=O)C(C(Cc1ccc(O)cc1)c1cccnc1)C(C#N)(O[Si](C)(C)C(C)(C)C)c1cccnc1 |
| InChI | InChI=1S/C30H37N3O4Si/c1-7-36-28(35)27(26(23-10-8-16-32-19-23)18-22-12-14-25(34)15-13-22)30(21-31,24-11-9-17-33-20-24)37-38(5,6)29(2,3)4/h8-17,19-20,26-27,34H,7,18H2,1-6H3 |
| InChIKey | OCWOYKLTHVIEBL-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.73 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|