C15H18BNO4 — CID 134850978
6-methyl-2-[(E,3S)-3-phenylbut-1-enyl]-1,3,6,2-dioxazaborocane-4,8-dione (PubChem CID 134850978) has the molecular formula C15H18BNO4 and a molecular weight of 287.12 g/mol. Its IUPAC name is 6-methyl-2-[(E,3S)-3-phenylbut-1-enyl]-1,3,6,2-dioxazaborocane-4,8-dione.
| Compound Name | 6-methyl-2-[(E,3S)-3-phenylbut-1-enyl]-1,3,6,2-dioxazaborocane-4,8-dione |
|---|---|
| PubChem CID | 134850978 |
| Molecular Formula | C15H18BNO4 |
| Molecular Weight | 287.12 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 6-methyl-2-[(E,3S)-3-phenylbut-1-enyl]-1,3,6,2-dioxazaborocane-4,8-dione |
| SMILES | C[C@@H](/C=C/B1OC(=O)CN(C)CC(=O)O1)c1ccccc1 |
| InChI | InChI=1S/C15H18BNO4/c1-12(13-6-4-3-5-7-13)8-9-16-20-14(18)10-17(2)11-15(19)21-16/h3-9,12H,10-11H2,1-2H3/b9-8+/t12-/m0/s1 |
| InChIKey | RFNARSZIOFHEAG-BCPZQOPPSA-N |
| XLogP | 1.41 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.12 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|