C24H32NO3P — CID 134851267
1-ditert-butylphosphoryl-6-(3,4-dimethoxyphenyl)indole (PubChem CID 134851267) has the molecular formula C24H32NO3P and a molecular weight of 413.50 g/mol. Its IUPAC name is 1-ditert-butylphosphoryl-6-(3,4-dimethoxyphenyl)indole.
| Compound Name | 1-ditert-butylphosphoryl-6-(3,4-dimethoxyphenyl)indole |
|---|---|
| PubChem CID | 134851267 |
| Molecular Formula | C24H32NO3P |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 1-ditert-butylphosphoryl-6-(3,4-dimethoxyphenyl)indole |
| SMILES | COc1ccc(-c2ccc3ccn(P(=O)(C(C)(C)C)C(C)(C)C)c3c2)cc1OC |
| InChI | InChI=1S/C24H32NO3P/c1-23(2,3)29(26,24(4,5)6)25-14-13-17-9-10-18(15-20(17)25)19-11-12-21(27-7)22(16-19)28-8/h9-16H,1-8H3 |
| InChIKey | VIAYIAITBAMBHP-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|