C42H40P2+2 — CID 134851634
methyl-[11-[methyl(diphenyl)phosphaniumyl]-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]-diphenylphosphanium (PubChem CID 134851634) has the molecular formula C42H40P2+2 and a molecular weight of 606.73 g/mol. Its IUPAC name is methyl-[11-[methyl(diphenyl)phosphaniumyl]-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]-diphenylphosphanium.
| Compound Name | methyl-[11-[methyl(diphenyl)phosphaniumyl]-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]-diphenylphosphanium |
|---|---|
| PubChem CID | 134851634 |
| Molecular Formula | C42H40P2+2 |
| Molecular Weight | 606.73 g/mol |
| Exact Mass | 606.26 |
| IUPAC Name | methyl-[11-[methyl(diphenyl)phosphaniumyl]-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]-diphenylphosphanium |
| SMILES | C[P+](c1ccccc1)(c1ccccc1)c1cc2ccc1CCc1ccc(c([P+](C)(c3ccccc3)c3ccccc3)c1)CC2 |
| InChI | InChI=1S/C42H40P2/c1-43(37-15-7-3-8-16-37,38-17-9-4-10-18-38)41-31-33-23-27-35(41)29-25-34-24-28-36(30-26-33)42(32-34)44(2,39-19-11-5-12-20-39)40-21-13-6-14-22-40/h3-24,27-28,31-32H,25-26,29-30H2,1-2H3/q+2 |
| InChIKey | CGQITTVVFAHMQE-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.73 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|