C19H22 — CID 101091322
5-(1,1,1-trideuteriopropan-2-yl)tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene (PubChem CID 101091322) has the molecular formula C19H22 and a molecular weight of 253.40 g/mol. Its IUPAC name is 5-(1,1,1-trideuteriopropan-2-yl)tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene.
| Compound Name | 5-(1,1,1-trideuteriopropan-2-yl)tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene |
|---|---|
| PubChem CID | 101091322 |
| Molecular Formula | C19H22 |
| Molecular Weight | 253.40 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | 5-(1,1,1-trideuteriopropan-2-yl)tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene |
| SMILES | [2H]C([2H])([2H])C(C)c1cc2ccc1CCc1ccc(cc1)CC2 |
| InChI | InChI=1S/C19H22/c1-14(2)19-13-17-8-7-15-3-5-16(6-4-15)9-11-18(19)12-10-17/h3-6,10,12-14H,7-9,11H2,1-2H3/i1D3 |
| InChIKey | XPLHGLBSKQCTIB-FIBGUPNXSA-N |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.40 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |