C46H44N2 — CID 101190100
(1S,2S)-N,N'-diphenyl-1,2-bis(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)ethane-1,2-diamine (PubChem CID 101190100) has the molecular formula C46H44N2 and a molecular weight of 624.87 g/mol. Its IUPAC name is (1S,2S)-N,N'-diphenyl-1,2-bis(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)ethane-1,2-diamine.
| Compound Name | (1S,2S)-N,N'-diphenyl-1,2-bis(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 101190100 |
| Molecular Formula | C46H44N2 |
| Molecular Weight | 624.87 g/mol |
| Exact Mass | 624.35 |
| IUPAC Name | (1S,2S)-N,N'-diphenyl-1,2-bis(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)ethane-1,2-diamine |
| SMILES | c1ccc(N[C@@H](c2cc3ccc2CCc2ccc(cc2)CC3)[C@@H](Nc2ccccc2)c2cc3ccc2CCc2ccc(cc2)CC3)cc1 |
| InChI | InChI=1S/C46H44N2/c1-3-7-41(8-4-1)47-45(43-31-37-21-19-33-11-15-35(16-12-33)23-27-39(43)29-25-37)46(48-42-9-5-2-6-10-42)44-32-38-22-20-34-13-17-36(18-14-34)24-28-40(44)30-26-38/h1-18,25-26,29-32,45-48H,19-24,27-28H2/t45-,46-/m0/s1 |
| InChIKey | HBGZNNAYJMVWQS-ZYBCLOSLSA-N |
| XLogP | 10.46 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.87 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |