C27H53NO3Si — CID 134852793
tert-butyl 6-[(3R)-3-[tert-butyl(dimethyl)silyl]oxyheptyl]-1-azaspiro[4.5]decane-1-carboxylate (PubChem CID 134852793) has the molecular formula C27H53NO3Si and a molecular weight of 467.81 g/mol. Its IUPAC name is tert-butyl 6-[(3R)-3-[tert-butyl(dimethyl)silyl]oxyheptyl]-1-azaspiro[4.5]decane-1-carboxylate.
| Compound Name | tert-butyl 6-[(3R)-3-[tert-butyl(dimethyl)silyl]oxyheptyl]-1-azaspiro[4.5]decane-1-carboxylate |
|---|---|
| PubChem CID | 134852793 |
| Molecular Formula | C27H53NO3Si |
| Molecular Weight | 467.81 g/mol |
| Exact Mass | 467.38 |
| IUPAC Name | tert-butyl 6-[(3R)-3-[tert-butyl(dimethyl)silyl]oxyheptyl]-1-azaspiro[4.5]decane-1-carboxylate |
| SMILES | CCCC[C@H](CCC1CCCCC12CCCN2C(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H53NO3Si/c1-10-11-16-23(31-32(8,9)26(5,6)7)18-17-22-15-12-13-19-27(22)20-14-21-28(27)24(29)30-25(2,3)4/h22-23H,10-21H2,1-9H3/t22?,23-,27?/m1/s1 |
| InChIKey | KGKCMPIDZNGPDX-ZOCBXBDSSA-N |
| XLogP | 8.31 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.81 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|