C37H74N2O4Si2 — CID 46894317
tert-butyl N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-N-[(1R,2S)-1-cyano-2-[(3S)-3-tri(propan-2-yl)silyloxyheptyl]cyclohexyl]carbamate (PubChem CID 46894317) has the molecular formula C37H74N2O4Si2 and a molecular weight of 667.18 g/mol. Its IUPAC name is tert-butyl N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-N-[(1R,2S)-1-cyano-2-[(3S)-3-tri(propan-2-yl)silyloxyheptyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-N-[(1R,2S)-1-cyano-2-[(3S)-3-tri(propan-2-yl)silyloxyheptyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 46894317 |
| Molecular Formula | C37H74N2O4Si2 |
| Molecular Weight | 667.18 g/mol |
| Exact Mass | 666.52 |
| IUPAC Name | tert-butyl N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-N-[(1R,2S)-1-cyano-2-[(3S)-3-tri(propan-2-yl)silyloxyheptyl]cyclohexyl]carbamate |
| SMILES | CCCC[C@@H](CC[C@@H]1CCCC[C@@]1(C#N)N(CCCO[Si](C)(C)C(C)(C)C)C(=O)OC(C)(C)C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C37H74N2O4Si2/c1-16-17-22-33(43-45(29(2)3,30(4)5)31(6)7)24-23-32-21-18-19-25-37(32,28-38)39(34(40)42-35(8,9)10)26-20-27-41-44(14,15)36(11,12)13/h29-33H,16-27H2,1-15H3/t32-,33-,37-/m0/s1 |
| InChIKey | IOUXZSONBBJBJI-BMQPFVSWSA-N |
| XLogP | 11.62 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.18 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|