C15H21NO7 — CID 134852943
(3R,6S)-2-(hydroxymethyl)-6-(2-phenylmethoxyiminoethoxy)oxane-3,4,5-triol (PubChem CID 134852943) has the molecular formula C15H21NO7 and a molecular weight of 327.33 g/mol. Its IUPAC name is (3R,6S)-2-(hydroxymethyl)-6-(2-phenylmethoxyiminoethoxy)oxane-3,4,5-triol.
| Compound Name | (3R,6S)-2-(hydroxymethyl)-6-(2-phenylmethoxyiminoethoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 134852943 |
| Molecular Formula | C15H21NO7 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | (3R,6S)-2-(hydroxymethyl)-6-(2-phenylmethoxyiminoethoxy)oxane-3,4,5-triol |
| SMILES | OCC1O[C@H](OCC=NOCc2ccccc2)C(O)C(O)[C@H]1O |
| InChI | InChI=1S/C15H21NO7/c17-8-11-12(18)13(19)14(20)15(23-11)21-7-6-16-22-9-10-4-2-1-3-5-10/h1-6,11-15,17-20H,7-9H2/t11?,12-,13?,14?,15-/m0/s1 |
| InChIKey | AUOJCUFXIZIKSM-HONHCDKBSA-N |
| XLogP | -0.99 |
| TPSA | 120.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|