C22H19NO4 — CID 134853623
ethyl (Z)-2-(3-hydroxy-1-methyl-2-oxoindol-3-yl)-5-phenylpent-2-en-4-ynoate (PubChem CID 134853623) has the molecular formula C22H19NO4 and a molecular weight of 361.40 g/mol. Its IUPAC name is ethyl (Z)-2-(3-hydroxy-1-methyl-2-oxoindol-3-yl)-5-phenylpent-2-en-4-ynoate.
| Compound Name | ethyl (Z)-2-(3-hydroxy-1-methyl-2-oxoindol-3-yl)-5-phenylpent-2-en-4-ynoate |
|---|---|
| PubChem CID | 134853623 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | ethyl (Z)-2-(3-hydroxy-1-methyl-2-oxoindol-3-yl)-5-phenylpent-2-en-4-ynoate |
| SMILES | CCOC(=O)/C(=C\C#Cc1ccccc1)C1(O)C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C22H19NO4/c1-3-27-20(24)18(14-9-12-16-10-5-4-6-11-16)22(26)17-13-7-8-15-19(17)23(2)21(22)25/h4-8,10-11,13-15,26H,3H2,1-2H3/b18-14+ |
| InChIKey | VYDQNPQOUYSTJI-NBVRZTHBSA-N |
| XLogP | 2.39 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|