C26H35NO6 — CID 134853644
ditert-butyl 1-cyclohexyl-2-hydroxy-5-oxo-2-phenylpyrrole-3,4-dicarboxylate (PubChem CID 134853644) has the molecular formula C26H35NO6 and a molecular weight of 457.57 g/mol. Its IUPAC name is ditert-butyl 1-cyclohexyl-2-hydroxy-5-oxo-2-phenylpyrrole-3,4-dicarboxylate.
| Compound Name | ditert-butyl 1-cyclohexyl-2-hydroxy-5-oxo-2-phenylpyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 134853644 |
| Molecular Formula | C26H35NO6 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | ditert-butyl 1-cyclohexyl-2-hydroxy-5-oxo-2-phenylpyrrole-3,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1=C(C(=O)OC(C)(C)C)C(O)(c2ccccc2)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C26H35NO6/c1-24(2,3)32-22(29)19-20(23(30)33-25(4,5)6)26(31,17-13-9-7-10-14-17)27(21(19)28)18-15-11-8-12-16-18/h7,9-10,13-14,18,31H,8,11-12,15-16H2,1-6H3 |
| InChIKey | JQJNQCJLVKMMSZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|