C42H44INO4 — CID 134853686
(2R,5R)-1-benzyl-2-(iodomethyl)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidine (PubChem CID 134853686) has the molecular formula C42H44INO4 and a molecular weight of 753.72 g/mol. Its IUPAC name is (2R,5R)-1-benzyl-2-(iodomethyl)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidine.
| Compound Name | (2R,5R)-1-benzyl-2-(iodomethyl)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidine |
|---|---|
| PubChem CID | 134853686 |
| Molecular Formula | C42H44INO4 |
| Molecular Weight | 753.72 g/mol |
| Exact Mass | 753.23 |
| IUPAC Name | (2R,5R)-1-benzyl-2-(iodomethyl)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidine |
| SMILES | IC[C@H]1C(OCc2ccccc2)C(OCc2ccccc2)[C@H](OCc2ccccc2)C(COCc2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C42H44INO4/c43-26-38-40(46-29-35-20-10-3-11-21-35)42(48-31-37-24-14-5-15-25-37)41(47-30-36-22-12-4-13-23-36)39(32-45-28-34-18-8-2-9-19-34)44(38)27-33-16-6-1-7-17-33/h1-25,38-42H,26-32H2/t38-,39?,40?,41+,42?/m0/s1 |
| InChIKey | KMNBWUOUVRQKDM-GIFDXDMQSA-N |
| XLogP | 8.65 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.72 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|