About (3S,4S)-1-ethyl-6-fluoro-3-(4-methylphenyl)sulfanyl-4-phenyl-3,4-dihydroquinolin-2-one
(3S,4S)-1-ethyl-6-fluoro-3-(4-methylphenyl)sulfanyl-4-phenyl-3,4-dihydroquinolin-2-one (PubChem CID 134854407) has the molecular formula C24H22FNOS
and a molecular weight of 391.51 g/mol. Its IUPAC name is (3S,4S)-1-ethyl-6-fluoro-3-(4-methylphenyl)sulfanyl-4-phenyl-3,4-dihydroquinolin-2-one.
Molecular Properties
| Compound Name | (3S,4S)-1-ethyl-6-fluoro-3-(4-methylphenyl)sulfanyl-4-phenyl-3,4-dihydroquinolin-2-one |
| PubChem CID | 134854407 |
| Molecular Formula | C24H22FNOS |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | (3S,4S)-1-ethyl-6-fluoro-3-(4-methylphenyl)sulfanyl-4-phenyl-3,4-dihydroquinolin-2-one |
| SMILES | CCN1C(=O)[C@@H](Sc2ccc(C)cc2)[C@@H](c2ccccc2)c2cc(F)ccc21 |
| InChI | InChI=1S/C24H22FNOS/c1-3-26-21-14-11-18(25)15-20(21)22(17-7-5-4-6-8-17)23(24(26)27)28-19-12-9-16(2)10-13-19/h4-15,22-23H,3H2,1-2H3/t22-,23-/m0/s1 |
| InChIKey | JXHPOWHUFFZDQA-GOTSBHOMSA-N |
| XLogP | 5.79 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S,4S)-1-ethyl-6-fluoro-3-(4-methylphenyl)sulfanyl-4-phenyl-3,4-dihydroquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-1-ethyl-6-fluoro-3-(4-methylphenyl)sulfanyl-4-phenyl-3,4-dihydroquinolin-2-one?
The IUPAC name of (3S,4S)-1-ethyl-6-fluoro-3-(4-methylphenyl)sulfanyl-4-phenyl-3,4-dihydroquinolin-2-one (CID 134854407) is (3S,4S)-1-ethyl-6-fluoro-3-(4-methylphenyl)sulfanyl-4-phenyl-3,4-dihydroquinolin-2-one.
What is the SMILES notation for (3S,4S)-1-ethyl-6-fluoro-3-(4-methylphenyl)sulfanyl-4-phenyl-3,4-dihydroquinolin-2-one?
The canonical SMILES for (3S,4S)-1-ethyl-6-fluoro-3-(4-methylphenyl)sulfanyl-4-phenyl-3,4-dihydroquinolin-2-one is CCN1C(=O)[C@@H](Sc2ccc(C)cc2)[C@@H](c2ccccc2)c2cc(F)ccc21.
What is the InChIKey of (3S,4S)-1-ethyl-6-fluoro-3-(4-methylphenyl)sulfanyl-4-phenyl-3,4-dihydroquinolin-2-one?
The InChIKey is JXHPOWHUFFZDQA-GOTSBHOMSA-N. The full InChI is InChI=1S/C24H22FNOS/c1-3-26-21-14-11-18(25)15-20(21)22(17-7-5-4-6-8-17)23(24(26)27)28-19-12-9-16(2)10-13-19/h4-15,22-23H,3H2,1-2H3/t22-,23-/m0/s1.
What are the key properties of (3S,4S)-1-ethyl-6-fluoro-3-(4-methylphenyl)sulfanyl-4-phenyl-3,4-dihydroquinolin-2-one?
(3S,4S)-1-ethyl-6-fluoro-3-(4-methylphenyl)sulfanyl-4-phenyl-3,4-dihydroquinolin-2-one has a molecular weight of 391.51 g/mol, XLogP of 5.79, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-1-ethyl-6-fluoro-3-(4-methylphenyl)sulfanyl-4-phenyl-3,4-dihydroquinolin-2-one is sourced from PubChem (CID 134854407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).