C13H24O3 — CID 134854683
(Z,2R)-5-(2,3-dimethyloxiran-2-yl)-6,6-dimethylhept-3-ene-2,5-diol (PubChem CID 134854683) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is (Z,2R)-5-(2,3-dimethyloxiran-2-yl)-6,6-dimethylhept-3-ene-2,5-diol.
| Compound Name | (Z,2R)-5-(2,3-dimethyloxiran-2-yl)-6,6-dimethylhept-3-ene-2,5-diol |
|---|---|
| PubChem CID | 134854683 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | (Z,2R)-5-(2,3-dimethyloxiran-2-yl)-6,6-dimethylhept-3-ene-2,5-diol |
| SMILES | CC1OC1(C)C(O)(/C=C\[C@@H](C)O)C(C)(C)C |
| InChI | InChI=1S/C13H24O3/c1-9(14)7-8-13(15,11(3,4)5)12(6)10(2)16-12/h7-10,14-15H,1-6H3/b8-7-/t9-,10?,12?,13?/m1/s1 |
| InChIKey | FEOHKONUJYKYIN-GMMCTLLXSA-N |
| XLogP | 1.88 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|