C20H26O7 — CID 134856980
methyl (1R,6R,8S,10E,12R,13R,15S,16R)-6,8,16-trimethyl-3,5,9-trioxo-2,14-dioxatricyclo[10.5.0.013,15]heptadec-10-ene-1-carboxylate (PubChem CID 134856980) has the molecular formula C20H26O7 and a molecular weight of 378.42 g/mol. Its IUPAC name is methyl (1R,6R,8S,10E,12R,13R,15S,16R)-6,8,16-trimethyl-3,5,9-trioxo-2,14-dioxatricyclo[10.5.0.013,15]heptadec-10-ene-1-carboxylate.
| Compound Name | methyl (1R,6R,8S,10E,12R,13R,15S,16R)-6,8,16-trimethyl-3,5,9-trioxo-2,14-dioxatricyclo[10.5.0.013,15]heptadec-10-ene-1-carboxylate |
|---|---|
| PubChem CID | 134856980 |
| Molecular Formula | C20H26O7 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | methyl (1R,6R,8S,10E,12R,13R,15S,16R)-6,8,16-trimethyl-3,5,9-trioxo-2,14-dioxatricyclo[10.5.0.013,15]heptadec-10-ene-1-carboxylate |
| SMILES | COC(=O)[C@@]12C[C@@H](C)[C@@H]3O[C@@H]3[C@H]1/C=C/C(=O)[C@@H](C)C[C@@H](C)C(=O)CC(=O)O2 |
| InChI | InChI=1S/C20H26O7/c1-10-7-11(2)15(22)8-16(23)27-20(19(24)25-4)9-12(3)17-18(26-17)13(20)5-6-14(10)21/h5-6,10-13,17-18H,7-9H2,1-4H3/b6-5+/t10-,11+,12+,13+,17-,18+,20+/m0/s1 |
| InChIKey | XLZVAKWMPHIVBB-APLUBIQHSA-N |
| XLogP | 1.63 |
| TPSA | 99.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|