C19H24O6 — CID 169026788
methyl (1R,2R,5S,7S,10Z,13S)-11-hydroxy-5,13-dimethyl-9,15-dioxo-8-oxatricyclo[8.6.0.02,7]hexadeca-3,10-diene-7-carboxylate (PubChem CID 169026788) has the molecular formula C19H24O6 and a molecular weight of 348.40 g/mol. Its IUPAC name is methyl (1R,2R,5S,7S,10Z,13S)-11-hydroxy-5,13-dimethyl-9,15-dioxo-8-oxatricyclo[8.6.0.02,7]hexadeca-3,10-diene-7-carboxylate.
| Compound Name | methyl (1R,2R,5S,7S,10Z,13S)-11-hydroxy-5,13-dimethyl-9,15-dioxo-8-oxatricyclo[8.6.0.02,7]hexadeca-3,10-diene-7-carboxylate |
|---|---|
| PubChem CID | 169026788 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | methyl (1R,2R,5S,7S,10Z,13S)-11-hydroxy-5,13-dimethyl-9,15-dioxo-8-oxatricyclo[8.6.0.02,7]hexadeca-3,10-diene-7-carboxylate |
| SMILES | COC(=O)[C@]12C[C@H](C)C=C[C@@H]1[C@H]1CC(=O)C[C@@H](C)C/C(O)=C\1C(=O)O2 |
| InChI | InChI=1S/C19H24O6/c1-10-4-5-14-13-8-12(20)6-11(2)7-15(21)16(13)17(22)25-19(14,9-10)18(23)24-3/h4-5,10-11,13-14,21H,6-9H2,1-3H3/b16-15-/t10-,11-,13-,14-,19+/m1/s1 |
| InChIKey | RCIRAOYDPJNRIG-ATWLXKDISA-N |
| XLogP | 2.48 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|