C19H23ClN2O5 — CID 13485923
1-(2-phenyl-6-pyrrolidin-1-ium-1-ylidenepyran-4-yl)pyrrolidine perchlorate (PubChem CID 13485923) has the molecular formula C19H23ClN2O5 and a molecular weight of 394.86 g/mol. Its IUPAC name is 1-(2-phenyl-6-pyrrolidin-1-ium-1-ylidenepyran-4-yl)pyrrolidine perchlorate.
| Compound Name | 1-(2-phenyl-6-pyrrolidin-1-ium-1-ylidenepyran-4-yl)pyrrolidine perchlorate |
|---|---|
| PubChem CID | 13485923 |
| Molecular Formula | C19H23ClN2O5 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 1-(2-phenyl-6-pyrrolidin-1-ium-1-ylidenepyran-4-yl)pyrrolidine perchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].c1ccc(-c2cc(N3CCCC3)cc(=[N+]3CCCC3)o2)cc1 |
| InChI | InChI=1S/C19H23N2O.ClHO4/c1-2-8-16(9-3-1)18-14-17(20-10-4-5-11-20)15-19(22-18)21-12-6-7-13-21;2-1(3,4)5/h1-3,8-9,14-15H,4-7,10-13H2;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | BIJFGFYVXAHSOA-UHFFFAOYSA-M |
| XLogP | -1.64 |
| TPSA | 111.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|