C15H16ClNO5 — CID 134911654
1-(6-phenylpyran-2-ylidene)pyrrolidin-1-ium perchlorate (PubChem CID 134911654) has the molecular formula C15H16ClNO5 and a molecular weight of 325.75 g/mol. Its IUPAC name is 1-(6-phenylpyran-2-ylidene)pyrrolidin-1-ium perchlorate.
| Compound Name | 1-(6-phenylpyran-2-ylidene)pyrrolidin-1-ium perchlorate |
|---|---|
| PubChem CID | 134911654 |
| Molecular Formula | C15H16ClNO5 |
| Molecular Weight | 325.75 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 1-(6-phenylpyran-2-ylidene)pyrrolidin-1-ium perchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].c1ccc(-c2cccc(=[N+]3CCCC3)o2)cc1 |
| InChI | InChI=1S/C15H16NO.ClHO4/c1-2-7-13(8-3-1)14-9-6-10-15(17-14)16-11-4-5-12-16;2-1(3,4)5/h1-3,6-10H,4-5,11-12H2;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | XUMVTZJALJYUAV-UHFFFAOYSA-M |
| XLogP | -2.24 |
| TPSA | 108.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.75 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|