C22H22ClNO5 — CID 51062071
1-(2,6-diphenylpyran-4-ylidene)piperidin-1-ium perchlorate (PubChem CID 51062071) has the molecular formula C22H22ClNO5 and a molecular weight of 415.87 g/mol. Its IUPAC name is 1-(2,6-diphenylpyran-4-ylidene)piperidin-1-ium perchlorate.
| Compound Name | 1-(2,6-diphenylpyran-4-ylidene)piperidin-1-ium perchlorate |
|---|---|
| PubChem CID | 51062071 |
| Molecular Formula | C22H22ClNO5 |
| Molecular Weight | 415.87 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 1-(2,6-diphenylpyran-4-ylidene)piperidin-1-ium perchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].c1ccc(-c2cc(=[N+]3CCCCC3)cc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C22H22NO.ClHO4/c1-4-10-18(11-5-1)21-16-20(23-14-8-3-9-15-23)17-22(24-21)19-12-6-2-7-13-19;2-1(3,4)5/h1-2,4-7,10-13,16-17H,3,8-9,14-15H2;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | WSZDLPVOURGNCA-UHFFFAOYSA-M |
| XLogP | -0.19 |
| TPSA | 108.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.87 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|