C19H23N2O+ — CID 13485920
1-(2-phenyl-6-pyrrolidin-1-ium-1-ylidenepyran-4-yl)pyrrolidine (PubChem CID 13485920) has the molecular formula C19H23N2O+ and a molecular weight of 295.41 g/mol. Its IUPAC name is 1-(2-phenyl-6-pyrrolidin-1-ium-1-ylidenepyran-4-yl)pyrrolidine.
| Compound Name | 1-(2-phenyl-6-pyrrolidin-1-ium-1-ylidenepyran-4-yl)pyrrolidine |
|---|---|
| PubChem CID | 13485920 |
| Molecular Formula | C19H23N2O+ |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 1-(2-phenyl-6-pyrrolidin-1-ium-1-ylidenepyran-4-yl)pyrrolidine |
| SMILES | c1ccc(-c2cc(N3CCCC3)cc(=[N+]3CCCC3)o2)cc1 |
| InChI | InChI=1S/C19H23N2O/c1-2-8-16(9-3-1)18-14-17(20-10-4-5-11-20)15-19(22-18)21-12-6-7-13-21/h1-3,8-9,14-15H,4-7,10-13H2/q+1 |
| InChIKey | GOPAUNUPFYGPHY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 19.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|