C20H20NO+ — CID 147999935
1-(4-methyl-2-phenylchromen-7-ylidene)pyrrolidin-1-ium (PubChem CID 147999935) has the molecular formula C20H20NO+ and a molecular weight of 290.39 g/mol. Its IUPAC name is 1-(4-methyl-2-phenylchromen-7-ylidene)pyrrolidin-1-ium.
| Compound Name | 1-(4-methyl-2-phenylchromen-7-ylidene)pyrrolidin-1-ium |
|---|---|
| PubChem CID | 147999935 |
| Molecular Formula | C20H20NO+ |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1-(4-methyl-2-phenylchromen-7-ylidene)pyrrolidin-1-ium |
| SMILES | Cc1cc(-c2ccccc2)oc2cc(=[N+]3CCCC3)ccc1-2 |
| InChI | InChI=1S/C20H20NO/c1-15-13-19(16-7-3-2-4-8-16)22-20-14-17(9-10-18(15)20)21-11-5-6-12-21/h2-4,7-10,13-14H,5-6,11-12H2,1H3/q+1 |
| InChIKey | IWSXFKNYWHOPEA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 16.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|