C15H24N2O2 — CID 134860431
N'-(4-methylnon-1-en-4-yl)furan-2-carbohydrazide (PubChem CID 134860431) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is N'-(4-methylnon-1-en-4-yl)furan-2-carbohydrazide.
| Compound Name | N'-(4-methylnon-1-en-4-yl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 134860431 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | N'-(4-methylnon-1-en-4-yl)furan-2-carbohydrazide |
| SMILES | C=CCC(C)(CCCCC)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C15H24N2O2/c1-4-6-7-11-15(3,10-5-2)17-16-14(18)13-9-8-12-19-13/h5,8-9,12,17H,2,4,6-7,10-11H2,1,3H3,(H,16,18) |
| InChIKey | LBRNOSZMUDVCIK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|