C15H20O5 — CID 134861074
ethyl (E)-3-[2-(3,4-dimethoxyphenyl)ethoxy]prop-2-enoate (PubChem CID 134861074) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is ethyl (E)-3-[2-(3,4-dimethoxyphenyl)ethoxy]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2-(3,4-dimethoxyphenyl)ethoxy]prop-2-enoate |
|---|---|
| PubChem CID | 134861074 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | ethyl (E)-3-[2-(3,4-dimethoxyphenyl)ethoxy]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/OCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H20O5/c1-4-20-15(16)8-10-19-9-7-12-5-6-13(17-2)14(11-12)18-3/h5-6,8,10-11H,4,7,9H2,1-3H3/b10-8+ |
| InChIKey | ZKMCINJQJZWMFU-CSKARUKUSA-N |
| XLogP | 2.34 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|