C9H12FN3O6 — CID 134862484
(2R,5S)-5-fluoro-6-(hydroxymethyl)-2-(2-nitroimidazol-1-yl)oxane-3,4-diol (PubChem CID 134862484) has the molecular formula C9H12FN3O6 and a molecular weight of 277.21 g/mol. Its IUPAC name is (2R,5S)-5-fluoro-6-(hydroxymethyl)-2-(2-nitroimidazol-1-yl)oxane-3,4-diol.
| Compound Name | (2R,5S)-5-fluoro-6-(hydroxymethyl)-2-(2-nitroimidazol-1-yl)oxane-3,4-diol |
|---|---|
| PubChem CID | 134862484 |
| Molecular Formula | C9H12FN3O6 |
| Molecular Weight | 277.21 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | (2R,5S)-5-fluoro-6-(hydroxymethyl)-2-(2-nitroimidazol-1-yl)oxane-3,4-diol |
| SMILES | O=[N+]([O-])c1nccn1[C@@H]1OC(CO)[C@@H](F)C(O)C1O |
| InChI | InChI=1S/C9H12FN3O6/c10-5-4(3-14)19-8(7(16)6(5)15)12-2-1-11-9(12)13(17)18/h1-2,4-8,14-16H,3H2/t4?,5-,6?,7?,8-/m1/s1 |
| InChIKey | MADZWLALDMYCHH-SSULDBOMSA-N |
| XLogP | -1.26 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.21 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|