C8H10IN3O5 — CID 71449630
(2S,3S,4S,5S)-2-((123I)iodomethyl)-5-(2-nitroimidazol-1-yl)oxolane-3,4-diol (PubChem CID 71449630) has the molecular formula C8H10IN3O5 and a molecular weight of 351.09 g/mol. Its IUPAC name is (2S,3S,4S,5S)-2-((123I)iodomethyl)-5-(2-nitroimidazol-1-yl)oxolane-3,4-diol.
| Compound Name | (2S,3S,4S,5S)-2-((123I)iodomethyl)-5-(2-nitroimidazol-1-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 71449630 |
| Molecular Formula | C8H10IN3O5 |
| Molecular Weight | 351.09 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | (2S,3S,4S,5S)-2-((123I)iodomethyl)-5-(2-nitroimidazol-1-yl)oxolane-3,4-diol |
| SMILES | O=[N+]([O-])c1nccn1[C@H]1O[C@H](C[123I])[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H10IN3O5/c9-3-4-5(13)6(14)7(17-4)11-2-1-10-8(11)12(15)16/h1-2,4-7,13-14H,3H2/t4-,5-,6+,7+/m1/s1/i9-4 |
| InChIKey | FWNOUYXMHAJQMU-FABMBBJFSA-N |
| XLogP | -0.15 |
| TPSA | 110.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.09 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|