C17H26N4O7 — CID 155606170
[(3S,4R)-2-(aminomethyl)-4-(2-methylpropanoyloxy)-5-(2-nitroimidazol-1-yl)oxolan-3-yl] 2,2-dimethylpropanoate (PubChem CID 155606170) has the molecular formula C17H26N4O7 and a molecular weight of 398.42 g/mol. Its IUPAC name is [(3S,4R)-2-(aminomethyl)-4-(2-methylpropanoyloxy)-5-(2-nitroimidazol-1-yl)oxolan-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(3S,4R)-2-(aminomethyl)-4-(2-methylpropanoyloxy)-5-(2-nitroimidazol-1-yl)oxolan-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 155606170 |
| Molecular Formula | C17H26N4O7 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | [(3S,4R)-2-(aminomethyl)-4-(2-methylpropanoyloxy)-5-(2-nitroimidazol-1-yl)oxolan-3-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)C(=O)O[C@H]1C(n2ccnc2[N+](=O)[O-])OC(CN)[C@@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C17H26N4O7/c1-9(2)14(22)27-12-11(28-15(23)17(3,4)5)10(8-18)26-13(12)20-7-6-19-16(20)21(24)25/h6-7,9-13H,8,18H2,1-5H3/t10?,11-,12+,13?/m0/s1 |
| InChIKey | SMKXTVCPISHUCX-CMOBGSAGSA-N |
| XLogP | 1.17 |
| TPSA | 148.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|