C12H15N3O8 — CID 56648421
[(2R,3R,4R,5S)-4-acetyloxy-2-(hydroxymethyl)-5-(2-nitroimidazol-1-yl)oxolan-3-yl] acetate (PubChem CID 56648421) has the molecular formula C12H15N3O8 and a molecular weight of 329.27 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-4-acetyloxy-2-(hydroxymethyl)-5-(2-nitroimidazol-1-yl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5S)-4-acetyloxy-2-(hydroxymethyl)-5-(2-nitroimidazol-1-yl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 56648421 |
| Molecular Formula | C12H15N3O8 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | [(2R,3R,4R,5S)-4-acetyloxy-2-(hydroxymethyl)-5-(2-nitroimidazol-1-yl)oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@@H](CO)O[C@@H]1n1ccnc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15N3O8/c1-6(17)21-9-8(5-16)23-11(10(9)22-7(2)18)14-4-3-13-12(14)15(19)20/h3-4,8-11,16H,5H2,1-2H3/t8-,9-,10-,11+/m1/s1 |
| InChIKey | FIXNLVKJBGADJW-DBIOUOCHSA-N |
| XLogP | -0.46 |
| TPSA | 143.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|