C15H21N5O8 — CID 141145563
[(2R,3R,4R,5R)-4-acetyloxy-5-(2-amino-6-hydroxy-6-methoxy-3H-purin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] acetate (PubChem CID 141145563) has the molecular formula C15H21N5O8 and a molecular weight of 399.36 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-acetyloxy-5-(2-amino-6-hydroxy-6-methoxy-3H-purin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5R)-4-acetyloxy-5-(2-amino-6-hydroxy-6-methoxy-3H-purin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 141145563 |
| Molecular Formula | C15H21N5O8 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | [(2R,3R,4R,5R)-4-acetyloxy-5-(2-amino-6-hydroxy-6-methoxy-3H-purin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] acetate |
| SMILES | COC1(O)N=C(N)Nc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H21N5O8/c1-6(22)26-9-8(4-21)28-13(10(9)27-7(2)23)20-5-17-11-12(20)18-14(16)19-15(11,24)25-3/h5,8-10,13,21,24H,4H2,1-3H3,(H3,16,18,19)/t8-,9-,10-,13-,15?/m1/s1 |
| InChIKey | ZSVMUPZBENOTLN-BHHFKTSFSA-N |
| XLogP | -1.87 |
| TPSA | 179.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|