C19H22N2O13 — CID 11049201
4-nitro-1-[(2S,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]pyrrole-2-carboxylic acid (PubChem CID 11049201) has the molecular formula C19H22N2O13 and a molecular weight of 486.39 g/mol. Its IUPAC name is 4-nitro-1-[(2S,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]pyrrole-2-carboxylic acid.
| Compound Name | 4-nitro-1-[(2S,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 11049201 |
| Molecular Formula | C19H22N2O13 |
| Molecular Weight | 486.39 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | 4-nitro-1-[(2S,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]pyrrole-2-carboxylic acid |
| SMILES | CC(=O)OC[C@H]1O[C@H](n2cc([N+](=O)[O-])cc2C(=O)O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H22N2O13/c1-8(22)30-7-14-15(31-9(2)23)16(32-10(3)24)17(33-11(4)25)18(34-14)20-6-12(21(28)29)5-13(20)19(26)27/h5-6,14-18H,7H2,1-4H3,(H,26,27)/t14-,15-,16-,17-,18+/m1/s1 |
| InChIKey | ZNTFTGINPAHWDY-ZKXLYKBJSA-N |
| XLogP | 0.35 |
| TPSA | 199.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.39 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|