C26H30N4O17S — CID 46829955
[(2R,3R,4S,5R)-4,5,6-triacetyloxy-2-[[3-(2-nitroimidazol-1-yl)-2-(4-nitrophenyl)sulfonyloxypropoxy]methyl]oxan-3-yl] acetate (PubChem CID 46829955) has the molecular formula C26H30N4O17S and a molecular weight of 702.60 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-4,5,6-triacetyloxy-2-[[3-(2-nitroimidazol-1-yl)-2-(4-nitrophenyl)sulfonyloxypropoxy]methyl]oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R)-4,5,6-triacetyloxy-2-[[3-(2-nitroimidazol-1-yl)-2-(4-nitrophenyl)sulfonyloxypropoxy]methyl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 46829955 |
| Molecular Formula | C26H30N4O17S |
| Molecular Weight | 702.60 g/mol |
| Exact Mass | 702.13 |
| IUPAC Name | [(2R,3R,4S,5R)-4,5,6-triacetyloxy-2-[[3-(2-nitroimidazol-1-yl)-2-(4-nitrophenyl)sulfonyloxypropoxy]methyl]oxan-3-yl] acetate |
| SMILES | CC(=O)OC1O[C@H](COCC(Cn2ccnc2[N+](=O)[O-])OS(=O)(=O)c2ccc([N+](=O)[O-])cc2)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C26H30N4O17S/c1-14(31)42-22-21(46-25(45-17(4)34)24(44-16(3)33)23(22)43-15(2)32)13-41-12-19(11-28-10-9-27-26(28)30(37)38)47-48(39,40)20-7-5-18(6-8-20)29(35)36/h5-10,19,21-25H,11-13H2,1-4H3/t19?,21-,22-,23+,24-,25?/m1/s1 |
| InChIKey | BEIWTIZWXHABCA-FGODVSHBSA-N |
| XLogP | 0.57 |
| TPSA | 271.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.60 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|