C8H11N3O7 — CID 101235214
(2R,3S,4R,5S)-2-(hydroxymethyl)-5-(2-nitroimidazol-1-yl)oxyoxolane-3,4-diol (PubChem CID 101235214) has the molecular formula C8H11N3O7 and a molecular weight of 261.19 g/mol. Its IUPAC name is (2R,3S,4R,5S)-2-(hydroxymethyl)-5-(2-nitroimidazol-1-yl)oxyoxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5S)-2-(hydroxymethyl)-5-(2-nitroimidazol-1-yl)oxyoxolane-3,4-diol |
|---|---|
| PubChem CID | 101235214 |
| Molecular Formula | C8H11N3O7 |
| Molecular Weight | 261.19 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | (2R,3S,4R,5S)-2-(hydroxymethyl)-5-(2-nitroimidazol-1-yl)oxyoxolane-3,4-diol |
| SMILES | O=[N+]([O-])c1nccn1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C8H11N3O7/c12-3-4-5(13)6(14)7(17-4)18-10-2-1-9-8(10)11(15)16/h1-2,4-7,12-14H,3H2/t4-,5-,6-,7+/m1/s1 |
| InChIKey | WKWLVEYEARCJRH-GBNDHIKLSA-N |
| XLogP | -2.34 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.19 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|