C29H46O4Si — CID 134863148
methyl (E)-3-[(1S,2R,5R,7R,8R,10S,11S,16R)-8-methoxy-2-methyl-16-triethylsilyloxy-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadec-13-enyl]prop-2-enoate (PubChem CID 134863148) has the molecular formula C29H46O4Si and a molecular weight of 486.77 g/mol. Its IUPAC name is methyl (E)-3-[(1S,2R,5R,7R,8R,10S,11S,16R)-8-methoxy-2-methyl-16-triethylsilyloxy-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadec-13-enyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(1S,2R,5R,7R,8R,10S,11S,16R)-8-methoxy-2-methyl-16-triethylsilyloxy-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadec-13-enyl]prop-2-enoate |
|---|---|
| PubChem CID | 134863148 |
| Molecular Formula | C29H46O4Si |
| Molecular Weight | 486.77 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | methyl (E)-3-[(1S,2R,5R,7R,8R,10S,11S,16R)-8-methoxy-2-methyl-16-triethylsilyloxy-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadec-13-enyl]prop-2-enoate |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C[C@H]2[C@@H](C[C@@H](OC)[C@]34C[C@H]3CC[C@]24C)[C@@H]2CC=C(/C=C/C(=O)OC)C21 |
| InChI | InChI=1S/C29H46O4Si/c1-7-34(8-2,9-3)33-24-17-23-22(21-12-10-19(27(21)24)11-13-26(30)32-6)16-25(31-5)29-18-20(29)14-15-28(23,29)4/h10-11,13,20-25,27H,7-9,12,14-18H2,1-6H3/b13-11+/t20-,21+,22+,23+,24-,25-,27?,28-,29+/m1/s1 |
| InChIKey | FRNVAKZUVSGEKI-BLEFINTESA-N |
| XLogP | 6.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.77 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|