C22H34O4 — CID 57326048
(1S,2R,5R,7R,8R,10R,11S,14R,15R)-14-[(1S)-1,2-dihydroxyethyl]-8-methoxy-2,15-dimethylpentacyclo[8.7.0.02,7.05,7.011,15]heptadecan-12-one (PubChem CID 57326048) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is (1S,2R,5R,7R,8R,10R,11S,14R,15R)-14-[(1S)-1,2-dihydroxyethyl]-8-methoxy-2,15-dimethylpentacyclo[8.7.0.02,7.05,7.011,15]heptadecan-12-one.
| Compound Name | (1S,2R,5R,7R,8R,10R,11S,14R,15R)-14-[(1S)-1,2-dihydroxyethyl]-8-methoxy-2,15-dimethylpentacyclo[8.7.0.02,7.05,7.011,15]heptadecan-12-one |
|---|---|
| PubChem CID | 57326048 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | (1S,2R,5R,7R,8R,10R,11S,14R,15R)-14-[(1S)-1,2-dihydroxyethyl]-8-methoxy-2,15-dimethylpentacyclo[8.7.0.02,7.05,7.011,15]heptadecan-12-one |
| SMILES | CO[C@@H]1C[C@H]2[C@@H]3C(=O)C[C@@H]([C@H](O)CO)[C@@]3(C)CC[C@@H]2[C@@]2(C)CC[C@@H]3C[C@]312 |
| InChI | InChI=1S/C22H34O4/c1-20-6-5-14-13(19(20)16(24)9-15(20)17(25)11-23)8-18(26-3)22-10-12(22)4-7-21(14,22)2/h12-15,17-19,23,25H,4-11H2,1-3H3/t12-,13-,14+,15+,17-,18-,19-,20-,21-,22+/m1/s1 |
| InChIKey | IFTMSTSYURHWKV-RELPDWLTSA-N |
| XLogP | 2.80 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |