About 1-[(2S,3R)-3-(5-methylhexyl)oxiran-2-yl]decan-1-ol
1-[(2S,3R)-3-(5-methylhexyl)oxiran-2-yl]decan-1-ol (PubChem CID 134864030) has the molecular formula C19H38O2
and a molecular weight of 298.51 g/mol. Its IUPAC name is 1-[(2S,3R)-3-(5-methylhexyl)oxiran-2-yl]decan-1-ol.
Molecular Properties
| Compound Name | 1-[(2S,3R)-3-(5-methylhexyl)oxiran-2-yl]decan-1-ol |
| PubChem CID | 134864030 |
| Molecular Formula | C19H38O2 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.29 |
| IUPAC Name | 1-[(2S,3R)-3-(5-methylhexyl)oxiran-2-yl]decan-1-ol |
| SMILES | CCCCCCCCCC(O)[C@@H]1O[C@@H]1CCCCC(C)C |
| InChI | InChI=1S/C19H38O2/c1-4-5-6-7-8-9-10-14-17(20)19-18(21-19)15-12-11-13-16(2)3/h16-20H,4-15H2,1-3H3/t17?,18-,19+/m1/s1 |
| InChIKey | CJZCKNOAOUINID-CPSIJMPNSA-N |
| XLogP | 5.47 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2S,3R)-3-(5-methylhexyl)oxiran-2-yl]decan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S,3R)-3-(5-methylhexyl)oxiran-2-yl]decan-1-ol?
The IUPAC name of 1-[(2S,3R)-3-(5-methylhexyl)oxiran-2-yl]decan-1-ol (CID 134864030) is 1-[(2S,3R)-3-(5-methylhexyl)oxiran-2-yl]decan-1-ol.
What is the SMILES notation for 1-[(2S,3R)-3-(5-methylhexyl)oxiran-2-yl]decan-1-ol?
The canonical SMILES for 1-[(2S,3R)-3-(5-methylhexyl)oxiran-2-yl]decan-1-ol is CCCCCCCCCC(O)[C@@H]1O[C@@H]1CCCCC(C)C.
What is the InChIKey of 1-[(2S,3R)-3-(5-methylhexyl)oxiran-2-yl]decan-1-ol?
The InChIKey is CJZCKNOAOUINID-CPSIJMPNSA-N. The full InChI is InChI=1S/C19H38O2/c1-4-5-6-7-8-9-10-14-17(20)19-18(21-19)15-12-11-13-16(2)3/h16-20H,4-15H2,1-3H3/t17?,18-,19+/m1/s1.
What are the key properties of 1-[(2S,3R)-3-(5-methylhexyl)oxiran-2-yl]decan-1-ol?
1-[(2S,3R)-3-(5-methylhexyl)oxiran-2-yl]decan-1-ol has a molecular weight of 298.51 g/mol, XLogP of 5.47, 14 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S,3R)-3-(5-methylhexyl)oxiran-2-yl]decan-1-ol is sourced from PubChem (CID 134864030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).