C18H20O6 — CID 134864163
(3R,7E,10S)-9,10-diethyl-3-methyl-5,14-dioxatricyclo[10.3.0.03,7]pentadeca-1(12),7-diene-4,6,13,15-tetrone (PubChem CID 134864163) has the molecular formula C18H20O6 and a molecular weight of 332.35 g/mol. Its IUPAC name is (3R,7E,10S)-9,10-diethyl-3-methyl-5,14-dioxatricyclo[10.3.0.03,7]pentadeca-1(12),7-diene-4,6,13,15-tetrone.
| Compound Name | (3R,7E,10S)-9,10-diethyl-3-methyl-5,14-dioxatricyclo[10.3.0.03,7]pentadeca-1(12),7-diene-4,6,13,15-tetrone |
|---|---|
| PubChem CID | 134864163 |
| Molecular Formula | C18H20O6 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (3R,7E,10S)-9,10-diethyl-3-methyl-5,14-dioxatricyclo[10.3.0.03,7]pentadeca-1(12),7-diene-4,6,13,15-tetrone |
| SMILES | CCC1/C=C2/C(=O)OC(=O)[C@]2(C)CC2=C(C[C@@H]1CC)C(=O)OC2=O |
| InChI | InChI=1S/C18H20O6/c1-4-9-6-11-12(15(20)23-14(11)19)8-18(3)13(7-10(9)5-2)16(21)24-17(18)22/h7,9-10H,4-6,8H2,1-3H3/b13-7-/t9-,10?,18+/m0/s1 |
| InChIKey | RUGDWJCVKKJESL-RKGMRMOESA-N |
| XLogP | 2.23 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|