C12H22O4 — CID 134865495
[(5aS,6S,8aR)-6-(hydroxymethyl)-3,3-dimethyl-5,5a,6,7,8,8a-hexahydro-1H-cyclopenta[e][1,3]dioxepin-8-yl]methanol (PubChem CID 134865495) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is [(5aS,6S,8aR)-6-(hydroxymethyl)-3,3-dimethyl-5,5a,6,7,8,8a-hexahydro-1H-cyclopenta[e][1,3]dioxepin-8-yl]methanol.
| Compound Name | [(5aS,6S,8aR)-6-(hydroxymethyl)-3,3-dimethyl-5,5a,6,7,8,8a-hexahydro-1H-cyclopenta[e][1,3]dioxepin-8-yl]methanol |
|---|---|
| PubChem CID | 134865495 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | [(5aS,6S,8aR)-6-(hydroxymethyl)-3,3-dimethyl-5,5a,6,7,8,8a-hexahydro-1H-cyclopenta[e][1,3]dioxepin-8-yl]methanol |
| SMILES | CC1(C)OC[C@H]2[C@@H](CO)CC(CO)[C@H]2CO1 |
| InChI | InChI=1S/C12H22O4/c1-12(2)15-6-10-8(4-13)3-9(5-14)11(10)7-16-12/h8-11,13-14H,3-7H2,1-2H3/t8-,9?,10+,11-/m1/s1 |
| InChIKey | NUXKVEKQVZVXEI-TVTJGUELSA-N |
| XLogP | 0.62 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |