C16H31BrO5 — CID 161359020
5-(2-bromoethyl)-2,2-dimethyl-1,3-dioxane;2-(2,2-dimethyl-1,3-dioxan-5-yl)ethanol (PubChem CID 161359020) has the molecular formula C16H31BrO5 and a molecular weight of 383.32 g/mol. Its IUPAC name is 5-(2-bromoethyl)-2,2-dimethyl-1,3-dioxane;2-(2,2-dimethyl-1,3-dioxan-5-yl)ethanol.
| Compound Name | 5-(2-bromoethyl)-2,2-dimethyl-1,3-dioxane;2-(2,2-dimethyl-1,3-dioxan-5-yl)ethanol |
|---|---|
| PubChem CID | 161359020 |
| Molecular Formula | C16H31BrO5 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 5-(2-bromoethyl)-2,2-dimethyl-1,3-dioxane;2-(2,2-dimethyl-1,3-dioxan-5-yl)ethanol |
| SMILES | CC1(C)OCC(CCBr)CO1.CC1(C)OCC(CCO)CO1 |
| InChI | InChI=1S/C8H15BrO2.C8H16O3/c2*1-8(2)10-5-7(3-4-9)6-11-8/h7H,3-6H2,1-2H3;7,9H,3-6H2,1-2H3 |
| InChIKey | VOXRNFPASQAGSF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|