C10H21NO4 — CID 123293472
2-[(7-amino-2,2-dimethyl-1,3-dioxocan-5-yl)oxy]ethanol (PubChem CID 123293472) has the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-[(7-amino-2,2-dimethyl-1,3-dioxocan-5-yl)oxy]ethanol.
| Compound Name | 2-[(7-amino-2,2-dimethyl-1,3-dioxocan-5-yl)oxy]ethanol |
|---|---|
| PubChem CID | 123293472 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 2-[(7-amino-2,2-dimethyl-1,3-dioxocan-5-yl)oxy]ethanol |
| SMILES | CC1(C)OCC(N)CC(OCCO)CO1 |
| InChI | InChI=1S/C10H21NO4/c1-10(2)14-6-8(11)5-9(7-15-10)13-4-3-12/h8-9,12H,3-7,11H2,1-2H3 |
| InChIKey | RZJFZXKCZBIVDH-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |