C15H29NO5 — CID 20812561
3-[bis(2,2-dimethyl-1,3-dioxan-5-yl)amino]propan-1-ol (PubChem CID 20812561) has the molecular formula C15H29NO5 and a molecular weight of 303.40 g/mol. Its IUPAC name is 3-[bis(2,2-dimethyl-1,3-dioxan-5-yl)amino]propan-1-ol.
| Compound Name | 3-[bis(2,2-dimethyl-1,3-dioxan-5-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 20812561 |
| Molecular Formula | C15H29NO5 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | 3-[bis(2,2-dimethyl-1,3-dioxan-5-yl)amino]propan-1-ol |
| SMILES | CC1(C)OCC(N(CCCO)C2COC(C)(C)OC2)CO1 |
| InChI | InChI=1S/C15H29NO5/c1-14(2)18-8-12(9-19-14)16(6-5-7-17)13-10-20-15(3,4)21-11-13/h12-13,17H,5-11H2,1-4H3 |
| InChIKey | TUCYSGNJXXKVOC-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |