C15H24O — CID 134866262
(5E)-3-ethynyl-6,10-dimethylundeca-5,9-dien-1-ol (PubChem CID 134866262) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is (5E)-3-ethynyl-6,10-dimethylundeca-5,9-dien-1-ol.
| Compound Name | (5E)-3-ethynyl-6,10-dimethylundeca-5,9-dien-1-ol |
|---|---|
| PubChem CID | 134866262 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (5E)-3-ethynyl-6,10-dimethylundeca-5,9-dien-1-ol |
| SMILES | C#CC(C/C=C(\C)CCC=C(C)C)CCO |
| InChI | InChI=1S/C15H24O/c1-5-15(11-12-16)10-9-14(4)8-6-7-13(2)3/h1,7,9,15-16H,6,8,10-12H2,2-4H3/b14-9+ |
| InChIKey | AJBQMUIUBDJJNF-NTEUORMPSA-N |
| XLogP | 3.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|