C16H29BrO5 — CID 134866658
(3R,4S,5R)-1-bromo-5-(2-methoxyethoxymethoxy)dodec-1-yne-3,4-diol (PubChem CID 134866658) has the molecular formula C16H29BrO5 and a molecular weight of 381.31 g/mol. Its IUPAC name is (3R,4S,5R)-1-bromo-5-(2-methoxyethoxymethoxy)dodec-1-yne-3,4-diol.
| Compound Name | (3R,4S,5R)-1-bromo-5-(2-methoxyethoxymethoxy)dodec-1-yne-3,4-diol |
|---|---|
| PubChem CID | 134866658 |
| Molecular Formula | C16H29BrO5 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | (3R,4S,5R)-1-bromo-5-(2-methoxyethoxymethoxy)dodec-1-yne-3,4-diol |
| SMILES | CCCCCCC[C@@H](OCOCCOC)[C@@H](O)[C@H](O)C#CBr |
| InChI | InChI=1S/C16H29BrO5/c1-3-4-5-6-7-8-15(16(19)14(18)9-10-17)22-13-21-12-11-20-2/h14-16,18-19H,3-8,11-13H2,1-2H3/t14-,15-,16+/m1/s1 |
| InChIKey | ASQQOSPCMWRLPA-OAGGEKHMSA-N |
| XLogP | 2.43 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|