C15H15BrO4 — CID 134866742
(1R)-4-bromo-8-(3,4-dimethoxyphenyl)-2-oxabicyclo[2.2.2]oct-5-en-3-one (PubChem CID 134866742) has the molecular formula C15H15BrO4 and a molecular weight of 339.19 g/mol. Its IUPAC name is (1R)-4-bromo-8-(3,4-dimethoxyphenyl)-2-oxabicyclo[2.2.2]oct-5-en-3-one.
| Compound Name | (1R)-4-bromo-8-(3,4-dimethoxyphenyl)-2-oxabicyclo[2.2.2]oct-5-en-3-one |
|---|---|
| PubChem CID | 134866742 |
| Molecular Formula | C15H15BrO4 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | (1R)-4-bromo-8-(3,4-dimethoxyphenyl)-2-oxabicyclo[2.2.2]oct-5-en-3-one |
| SMILES | COc1ccc(C2C[C@@H]3C=CC2(Br)C(=O)O3)cc1OC |
| InChI | InChI=1S/C15H15BrO4/c1-18-12-4-3-9(7-13(12)19-2)11-8-10-5-6-15(11,16)14(17)20-10/h3-7,10-11H,8H2,1-2H3/t10-,11?,15?/m0/s1 |
| InChIKey | GGWGRNHJUBDWLY-NLTNOIMHSA-N |
| XLogP | 2.81 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|